| ImmunCR Id : | ICR11 |
| Chemical Name : | Silymarin |
| Plant Source : | Silybum marianum |
| Nutraceutical information : | Edible, High nutritional content in Artichokes and Milk Thistle |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | Hepatoprotective, anti-tumor, effective against neurologic diseases, and other diseases see reference. Inhibit CD4+ cells proliferation, formation of INF-γ and IL-2 and p65/NF-B phosphorylation |
| Description : | A combination of flavonoids that were taken from the milk thistle, Silybum marianum, seed. The main components are silybin and the isomers silicristin and silidianin. The antioxidant and membrane-stabilizing properties of silymarin are demonstrated. |
| IUPAC Name | 3,5,7-trihydroxy-2-[3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-2,3-dihydrochromen-4-one |
| SMILES | COC1=C(C=CC(=C1)C2C(OC3=C(O2)C=C(C=C3)C4C(C(=O)C5=C(C=C(C=C5O4)O)O)O)CO)O |
| Formula | C25H22O10 |
| InchiKey | SEBFKMXJBCUCAI-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Lignans, neolignans and related compounds |
| Class | Flavonolignans |
| Subclass | --- |
| LogP | 2.592 |
| Molecular weight | 482.436 |
| Hydrogen Bond Acceptor | 10 |
| Hydrogen Bond Donor | 5 |
| Polar surface area | 157.098 |
| No. of rotatable bonds | 4 |
| Number of Aromatic Rings | 3 |
| Number of rings | 5 |
| Absorption level | Very low |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Inhibitor |
