| ImmunCR Id : | ICR102 |
| Chemical Name : | Chavicine |
| Plant Source : | Piper cubeba |
| Nutraceutical information : | Edible, Black pepper |
| Mode of administration : | Oral |
| Immunomodulatory mechanism : | --- |
| Description : | Chavicine is a geometric isomer of piperine, have different structure with same molecular formula. It is responsible for the sharp fragrance of fresh ground pepper. Upon storage and loss of its sharp smell, chavicine is converted to piperine. |
| IUPAC Name | (2Z,4Z)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
| SMILES | C1CCN(CC1)C(=O)C=CC=CC2=CC3=C(C=C2)OCO3 |
| Formula | C17H19NO3 |
| InchiKey | MXXWOMGUGJBKIW-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Alkaloids and derivatives |
| Class | --- |
| Subclass | --- |
| LogP | 2.864 |
| Molecular weight | 285.338 |
| Hydrogen Bond Acceptor | 3 |
| Hydrogen Bond Donor | 0 |
| Polar surface area | 38.513 |
| No. of rotatable bonds | 3 |
| Number of Aromatic Rings | 1 |
| Number of rings | 3 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | High |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
