| ImmunCR Id : | ICR10 |
| Chemical Name : | Vitexin (Apigenin‐8‐C‐β‐D‐glucopyranoside) |
| Plant Source : | Jatropha curcas |
| Nutraceutical information : | Edible, High content in Buckwheat seed |
| Mode of administration : | IP, Injection |
| Immunomodulatory mechanism : | Anti-cancer, anti-inflammatory, anti-hypoxia/ischemia injury, and anti-viral activities, antineoplastic effects through several signaling pathways, such as apoptosis and autophagy. Stimulation humoral and cell-mediated immune responses Protection against Newcastle disease |
| Description : | The apigenin flavone glycoside vitexin is present in pearl millet, bamboo leaves, and passion flower. It functions as a plant metabolite, antineoplastic agent, EC 3.2. 1.20 (alpha-glucosidase) inhibitor, and a platelet aggregation inhibitor. It is a trihydroxyflavone and a C-glycosyl molecule. |
| IUPAC Name | --- |
| SMILES | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4C(C(C(C(O4)CO)O)O)O)O |
| Formula | C21H20O10 |
| InchiKey | SGEWCQFRYRRZDC-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Phenylpropanoids and polyketides |
| Class | Flavonoids |
| Subclass | Flavonoid glycosides |
| LogP | 0.018 |
| Molecular weight | 432.378 |
| Hydrogen Bond Acceptor | 10 |
| Hydrogen Bond Donor | 7 |
| Polar surface area | 180.869 |
| No. of rotatable bonds | 3 |
| Number of Aromatic Rings | 2 |
| Number of rings | 4 |
| Absorption level | Very low |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
